C19H32N4O2 — CID 111942437
2-[4-[2-[[N-ethyl-N'-(4-methylpentyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide (PubChem CID 111942437) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[4-[2-[[N-ethyl-N'-(4-methylpentyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide.
| Compound Name | 2-[4-[2-[[N-ethyl-N'-(4-methylpentyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111942437 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2-[4-[2-[[N-ethyl-N'-(4-methylpentyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\CCCC(C)C)NCCc1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C19H32N4O2/c1-4-21-19(22-12-5-6-15(2)3)23-13-11-16-7-9-17(10-8-16)25-14-18(20)24/h7-10,15H,4-6,11-14H2,1-3H3,(H2,20,24)(H2,21,22,23) |
| InChIKey | VOICXHQYDWICTO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|