C17H25N7O2 — CID 111707653
2-[4-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide (PubChem CID 111707653) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide.
| Compound Name | 2-[4-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111707653 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-[4-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCc1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C17H25N7O2/c1-3-19-17(21-10-16-22-12-23-24(16)2)20-9-8-13-4-6-14(7-5-13)26-11-15(18)25/h4-7,12H,3,8-11H2,1-2H3,(H2,18,25)(H2,19,20,21) |
| InChIKey | OXRWNMXJZGJTMI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|