C16H23ClN6 — CID 111705765
1-[3-(4-chlorophenyl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111705765) has the molecular formula C16H23ClN6 and a molecular weight of 334.86 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[3-(4-chlorophenyl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111705765 |
| Molecular Formula | C16H23ClN6 |
| Molecular Weight | 334.86 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-[3-(4-chlorophenyl)propyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23ClN6/c1-3-18-16(20-11-15-21-12-22-23(15)2)19-10-4-5-13-6-8-14(17)9-7-13/h6-9,12H,3-5,10-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | BECXTTZHJILHHV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.86 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|