C13H22N8 — CID 111705169
1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111705169) has the molecular formula C13H22N8 and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111705169 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCCn1cccn1 |
| InChI | InChI=1S/C13H22N8/c1-3-14-13(16-10-12-17-11-19-20(12)2)15-6-4-8-21-9-5-7-18-21/h5,7,9,11H,3-4,6,8,10H2,1-2H3,(H2,14,15,16) |
| InChIKey | AAJSOMZQZPTEIH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|