C15H31N7 — CID 111708423
1-[4-(diethylamino)butyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111708423) has the molecular formula C15H31N7 and a molecular weight of 309.46 g/mol. Its IUPAC name is 1-[4-(diethylamino)butyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[4-(diethylamino)butyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111708423 |
| Molecular Formula | C15H31N7 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | 1-[4-(diethylamino)butyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCCCN(CC)CC |
| InChI | InChI=1S/C15H31N7/c1-5-16-15(18-12-14-19-13-20-21(14)4)17-10-8-9-11-22(6-2)7-3/h13H,5-12H2,1-4H3,(H2,16,17,18) |
| InChIKey | LYOMBUYZEWCDFW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|