C13H24F3N7 — CID 111707909
1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 111707909) has the molecular formula C13H24F3N7 and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111707909 |
| Molecular Formula | C13H24F3N7 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C13H24F3N7/c1-4-17-12(19-8-11-20-10-21-23(11)3)18-6-5-7-22(2)9-13(14,15)16/h10H,4-9H2,1-3H3,(H2,17,18,19) |
| InChIKey | NSUXQKWQHZCVBN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|