C14H28IN7O — CID 111705280
N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111705280) has the molecular formula C14H28IN7O and a molecular weight of 437.33 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111705280 |
| Molecular Formula | C14H28IN7O |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCNC(=O)C(C)(C)C.I |
| InChI | InChI=1S/C14H27N7O.HI/c1-6-15-13(18-9-11-19-10-20-21(11)5)17-8-7-16-12(22)14(2,3)4;/h10H,6-9H2,1-5H3,(H,16,22)(H2,15,17,18);1H |
| InChIKey | QLRUKPLENMFEAM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|