C14H27N7O2 — CID 111706157
tert-butyl N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111706157) has the molecular formula C14H27N7O2 and a molecular weight of 325.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111706157 |
| Molecular Formula | C14H27N7O2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27N7O2/c1-6-15-12(18-9-11-19-10-20-21(11)5)16-7-8-17-13(22)23-14(2,3)4/h10H,6-9H2,1-5H3,(H,17,22)(H2,15,16,18) |
| InChIKey | RGAYUHWGJXUSHB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|