C19H36N8O2 — CID 111707875
tert-butyl 4-[3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 111707875) has the molecular formula C19H36N8O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is tert-butyl 4-[3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111707875 |
| Molecular Formula | C19H36N8O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | tert-butyl 4-[3-[[N-ethyl-N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H36N8O2/c1-6-20-17(22-14-16-23-15-24-25(16)5)21-8-7-9-26-10-12-27(13-11-26)18(28)29-19(2,3)4/h15H,6-14H2,1-5H3,(H2,20,21,22) |
| InChIKey | COTNVDJEOULKAO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|