C19H39N5O3 — CID 111894839
tert-butyl 4-[3-[[(2-ethoxyethylamino)-(ethylamino)methylidene]amino]propyl]piperazine-1-carboxylate (PubChem CID 111894839) has the molecular formula C19H39N5O3 and a molecular weight of 385.55 g/mol. Its IUPAC name is tert-butyl 4-[3-[[(2-ethoxyethylamino)-(ethylamino)methylidene]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[(2-ethoxyethylamino)-(ethylamino)methylidene]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111894839 |
| Molecular Formula | C19H39N5O3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.31 |
| IUPAC Name | tert-butyl 4-[3-[[(2-ethoxyethylamino)-(ethylamino)methylidene]amino]propyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCCN1CCN(C(=O)OC(C)(C)C)CC1)NCCOCC |
| InChI | InChI=1S/C19H39N5O3/c1-6-20-17(22-10-16-26-7-2)21-9-8-11-23-12-14-24(15-13-23)18(25)27-19(3,4)5/h6-16H2,1-5H3,(H2,20,21,22) |
| InChIKey | ZUZRZIFHPZXGPQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|