C19H38N6O3 — CID 111886269
tert-butyl N-[3-[[[2-(4-acetylpiperazin-1-yl)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate (PubChem CID 111886269) has the molecular formula C19H38N6O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is tert-butyl N-[3-[[[2-(4-acetylpiperazin-1-yl)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[[2-(4-acetylpiperazin-1-yl)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886269 |
| Molecular Formula | C19H38N6O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | tert-butyl N-[3-[[[2-(4-acetylpiperazin-1-yl)ethylamino]-(ethylamino)methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H38N6O3/c1-6-20-17(21-8-7-9-23-18(27)28-19(3,4)5)22-10-11-24-12-14-25(15-13-24)16(2)26/h6-15H2,1-5H3,(H,23,27)(H2,20,21,22) |
| InChIKey | AHMNQUNXIYCPJR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|