C17H35N5O3 — CID 111887387
tert-butyl N-[3-[[ethylamino-[2-(2-methylpropanoylamino)ethylamino]methylidene]amino]propyl]carbamate (PubChem CID 111887387) has the molecular formula C17H35N5O3 and a molecular weight of 357.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[2-(2-methylpropanoylamino)ethylamino]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[ethylamino-[2-(2-methylpropanoylamino)ethylamino]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887387 |
| Molecular Formula | C17H35N5O3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[2-(2-methylpropanoylamino)ethylamino]methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCNC(=O)C(C)C |
| InChI | InChI=1S/C17H35N5O3/c1-7-18-15(21-12-11-19-14(23)13(2)3)20-9-8-10-22-16(24)25-17(4,5)6/h13H,7-12H2,1-6H3,(H,19,23)(H,22,24)(H2,18,20,21) |
| InChIKey | AHQNQTBWQFNJBM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|