C19H41N5O2 — CID 111887153
tert-butyl N-[3-[[ethylamino-[4-[methyl(propan-2-yl)amino]butylamino]methylidene]amino]propyl]carbamate (PubChem CID 111887153) has the molecular formula C19H41N5O2 and a molecular weight of 371.57 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[4-[methyl(propan-2-yl)amino]butylamino]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[ethylamino-[4-[methyl(propan-2-yl)amino]butylamino]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887153 |
| Molecular Formula | C19H41N5O2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.33 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[4-[methyl(propan-2-yl)amino]butylamino]methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCCCN(C)C(C)C |
| InChI | InChI=1S/C19H41N5O2/c1-8-20-17(21-12-9-10-15-24(7)16(2)3)22-13-11-14-23-18(25)26-19(4,5)6/h16H,8-15H2,1-7H3,(H,23,25)(H2,20,21,22) |
| InChIKey | FRHXBVHJLHPEHM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|