C16H32F3N5O2 — CID 111885119
tert-butyl N-[2-[[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885119) has the molecular formula C16H32F3N5O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885119 |
| Molecular Formula | C16H32F3N5O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32F3N5O2/c1-6-20-13(21-8-7-11-24(5)12-16(17,18)19)22-9-10-23-14(25)26-15(2,3)4/h6-12H2,1-5H3,(H,23,25)(H2,20,21,22) |
| InChIKey | TWEVMOQMHDBSES-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|