C14H29F3N4 — CID 111128409
1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-pentylguanidine (PubChem CID 111128409) has the molecular formula C14H29F3N4 and a molecular weight of 310.41 g/mol. Its IUPAC name is 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-pentylguanidine.
| Compound Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-pentylguanidine |
|---|---|
| PubChem CID | 111128409 |
| Molecular Formula | C14H29F3N4 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-pentylguanidine |
| SMILES | CCCCCN/C(=N/CCCN(C)CC(F)(F)F)NCC |
| InChI | InChI=1S/C14H29F3N4/c1-4-6-7-9-19-13(18-5-2)20-10-8-11-21(3)12-14(15,16)17/h4-12H2,1-3H3,(H2,18,19,20) |
| InChIKey | PWOBXKGKSKLMNQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|