C14H28F3N3O — CID 111160875
1-ethyl-3-hexyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111160875) has the molecular formula C14H28F3N3O and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-ethyl-3-hexyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-hexyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111160875 |
| Molecular Formula | C14H28F3N3O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-ethyl-3-hexyl-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCCCCCN/C(=N/CCCOCC(F)(F)F)NCC |
| InChI | InChI=1S/C14H28F3N3O/c1-3-5-6-7-9-19-13(18-4-2)20-10-8-11-21-12-14(15,16)17/h3-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | DGPFXFQZTRSFQI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|