C13H26F3N3O — CID 110977407
1-ethyl-3-(3-methylbutyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 110977407) has the molecular formula C13H26F3N3O and a molecular weight of 297.37 g/mol. Its IUPAC name is 1-ethyl-3-(3-methylbutyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-3-(3-methylbutyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 110977407 |
| Molecular Formula | C13H26F3N3O |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 1-ethyl-3-(3-methylbutyl)-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)NCCC(C)C |
| InChI | InChI=1S/C13H26F3N3O/c1-4-17-12(19-8-6-11(2)3)18-7-5-9-20-10-13(14,15)16/h11H,4-10H2,1-3H3,(H2,17,18,19) |
| InChIKey | XBNLMPQMIXSPCO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|