C16H27F3IN5 — CID 111192909
1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111192909) has the molecular formula C16H27F3IN5 and a molecular weight of 473.33 g/mol. Its IUPAC name is 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111192909 |
| Molecular Formula | C16H27F3IN5 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 1-ethyl-2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)NCCc1ccccn1.I |
| InChI | InChI=1S/C16H26F3N5.HI/c1-3-20-15(23-11-8-14-7-4-5-9-21-14)22-10-6-12-24(2)13-16(17,18)19;/h4-5,7,9H,3,6,8,10-13H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | FCYLKZGAUKGQDU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|