C16H30IN5O2S — CID 111192631
1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111192631) has the molecular formula C16H30IN5O2S and a molecular weight of 483.42 g/mol. Its IUPAC name is 1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111192631 |
| Molecular Formula | C16H30IN5O2S |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 1-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)NCCc1ccccn1.I |
| InChI | InChI=1S/C16H29N5O2S.HI/c1-4-17-16(20-13-10-15-9-6-7-11-18-15)19-12-8-14-21(5-2)24(3,22)23;/h6-7,9,11H,4-5,8,10,12-14H2,1-3H3,(H2,17,19,20);1H |
| InChIKey | ZOQAZLVULKRYMG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|