C17H30ClIN4O2S — CID 111196653
1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine;hydroiodide (PubChem CID 111196653) has the molecular formula C17H30ClIN4O2S and a molecular weight of 516.88 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111196653 |
| Molecular Formula | C17H30ClIN4O2S |
| Molecular Weight | 516.88 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)NCCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C17H29ClN4O2S.HI/c1-4-19-17(20-12-6-14-22(5-2)25(3,23)24)21-13-11-15-7-9-16(18)10-8-15;/h7-10H,4-6,11-14H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | SKDVIBDXTNKKRT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|