C21H29ClIN3O2S — CID 111196747
2-(3-benzylsulfonylpropyl)-1-[2-(4-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111196747) has the molecular formula C21H29ClIN3O2S and a molecular weight of 549.91 g/mol. Its IUPAC name is 2-(3-benzylsulfonylpropyl)-1-[2-(4-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(3-benzylsulfonylpropyl)-1-[2-(4-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111196747 |
| Molecular Formula | C21H29ClIN3O2S |
| Molecular Weight | 549.91 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 2-(3-benzylsulfonylpropyl)-1-[2-(4-chlorophenyl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)NCCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C21H28ClN3O2S.HI/c1-2-23-21(25-15-13-18-9-11-20(22)12-10-18)24-14-6-16-28(26,27)17-19-7-4-3-5-8-19;/h3-5,7-12H,2,6,13-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | WOCUSZNCDTVDNT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|