C20H36IN3O3S — CID 111971733
2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(3-methylbutoxy)ethyl]guanidine;hydroiodide (PubChem CID 111971733) has the molecular formula C20H36IN3O3S and a molecular weight of 525.50 g/mol. Its IUPAC name is 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(3-methylbutoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(3-methylbutoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111971733 |
| Molecular Formula | C20H36IN3O3S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(3-methylbutoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)NCCOCCC(C)C.I |
| InChI | InChI=1S/C20H35N3O3S.HI/c1-4-21-20(23-13-15-26-14-11-18(2)3)22-12-8-16-27(24,25)17-19-9-6-5-7-10-19;/h5-7,9-10,18H,4,8,11-17H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ZJGWLKRHMNASEJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|