C21H37N3O3S — CID 111714722
1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine (PubChem CID 111714722) has the molecular formula C21H37N3O3S and a molecular weight of 411.61 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine.
| Compound Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
|---|---|
| PubChem CID | 111714722 |
| Molecular Formula | C21H37N3O3S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
| SMILES | CCN/C(=N\CC(CCO)CC(C)C)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H37N3O3S/c1-4-22-21(24-16-20(11-13-25)15-18(2)3)23-12-8-14-28(26,27)17-19-9-6-5-7-10-19/h5-7,9-10,18,20,25H,4,8,11-17H2,1-3H3,(H2,22,23,24) |
| InChIKey | QQFDYZDWIWJWBO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|