C22H32IN3O3S — CID 109408980
1-(3-benzylsulfonylpropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 109408980) has the molecular formula C22H32IN3O3S and a molecular weight of 545.49 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109408980 |
| Molecular Formula | C22H32IN3O3S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCCS(=O)(=O)Cc1ccccc1.I |
| InChI | InChI=1S/C22H31N3O3S.HI/c1-2-23-22(25-16-21(17-26)20-12-7-4-8-13-20)24-14-9-15-29(27,28)18-19-10-5-3-6-11-19;/h3-8,10-13,21,26H,2,9,14-18H2,1H3,(H2,23,24,25);1H |
| InChIKey | KORBAILQMGMVNW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|