C21H31IN4O — CID 109410366
1-(3-anilinopropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 109410366) has the molecular formula C21H31IN4O and a molecular weight of 482.41 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3-anilinopropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109410366 |
| Molecular Formula | C21H31IN4O |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-(3-anilinopropyl)-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCCNc1ccccc1.I |
| InChI | InChI=1S/C21H30N4O.HI/c1-2-22-21(24-15-9-14-23-20-12-7-4-8-13-20)25-16-19(17-26)18-10-5-3-6-11-18;/h3-8,10-13,19,23,26H,2,9,14-17H2,1H3,(H2,22,24,25);1H |
| InChIKey | VWKKKGIDRGJGQT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|