C15H22F3N3O — CID 109407885
1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109407885) has the molecular formula C15H22F3N3O and a molecular weight of 317.36 g/mol. Its IUPAC name is 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109407885 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCC(F)(F)F |
| InChI | InChI=1S/C15H22F3N3O/c1-2-19-14(20-9-8-15(16,17)18)21-10-13(11-22)12-6-4-3-5-7-12/h3-7,13,22H,2,8-11H2,1H3,(H2,19,20,21) |
| InChIKey | SNLMJOIKPWMFFC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|