C21H29N3O — CID 109410705
1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3-phenylpropyl)guanidine (PubChem CID 109410705) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3-phenylpropyl)guanidine.
| Compound Name | 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109410705 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 1-ethyl-2-(3-hydroxy-2-phenylpropyl)-3-(3-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O/c1-2-22-21(23-15-9-12-18-10-5-3-6-11-18)24-16-20(17-25)19-13-7-4-8-14-19/h3-8,10-11,13-14,20,25H,2,9,12,15-17H2,1H3,(H2,22,23,24) |
| InChIKey | SZMRSPJXYCNXJY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|