C20H29IN4O2S — CID 109408511
N-[3-[[N-ethyl-N'-(3-hydroxy-2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 109408511) has the molecular formula C20H29IN4O2S and a molecular weight of 516.45 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-(3-hydroxy-2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-ethyl-N'-(3-hydroxy-2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109408511 |
| Molecular Formula | C20H29IN4O2S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[3-[[N-ethyl-N'-(3-hydroxy-2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCCNC(=O)c1cccs1.I |
| InChI | InChI=1S/C20H28N4O2S.HI/c1-2-21-20(24-14-17(15-25)16-8-4-3-5-9-16)23-12-7-11-22-19(26)18-10-6-13-27-18;/h3-6,8-10,13,17,25H,2,7,11-12,14-15H2,1H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | RHISAHYACACEIM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|