C19H27IN4OS — CID 111244196
N-[3-[[N-ethyl-N'-[(4-methylphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111244196) has the molecular formula C19H27IN4OS and a molecular weight of 486.42 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-[(4-methylphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-ethyl-N'-[(4-methylphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111244196 |
| Molecular Formula | C19H27IN4OS |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[3-[[N-ethyl-N'-[(4-methylphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NCCCNC(=O)c1cccs1.I |
| InChI | InChI=1S/C19H26N4OS.HI/c1-3-20-19(23-14-16-9-7-15(2)8-10-16)22-12-5-11-21-18(24)17-6-4-13-25-17;/h4,6-10,13H,3,5,11-12,14H2,1-2H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | ZFYKBAOHGQTGBJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|