C24H35N5OS — CID 111411373
N-[3-[[N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide (PubChem CID 111411373) has the molecular formula C24H35N5OS and a molecular weight of 441.65 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111411373 |
| Molecular Formula | C24H35N5OS |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | N-[3-[[N-ethyl-N'-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCCC2)cc1)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C24H35N5OS/c1-2-25-24(27-14-7-13-26-23(30)22-8-6-17-31-22)28-18-20-9-11-21(12-10-20)19-29-15-4-3-5-16-29/h6,8-12,17H,2-5,7,13-16,18-19H2,1H3,(H,26,30)(H2,25,27,28) |
| InChIKey | VPPPTSRRQKTBJM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|