C18H23ClN4OS — CID 111175301
N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide (PubChem CID 111175301) has the molecular formula C18H23ClN4OS and a molecular weight of 378.93 g/mol. Its IUPAC name is N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111175301 |
| Molecular Formula | C18H23ClN4OS |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[3-[[N'-[(2-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C18H23ClN4OS/c1-2-20-18(23-13-14-7-3-4-8-15(14)19)22-11-6-10-21-17(24)16-9-5-12-25-16/h3-5,7-9,12H,2,6,10-11,13H2,1H3,(H,21,24)(H2,20,22,23) |
| InChIKey | YBEVKDKNIMAEAK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|