C20H29IN4OS — CID 111342682
N-[3-[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111342682) has the molecular formula C20H29IN4OS and a molecular weight of 500.45 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111342682 |
| Molecular Formula | C20H29IN4OS |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-[3-[[N-ethyl-N'-(2-phenylpropyl)carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccccc1)NCCCNC(=O)c1cccs1.I |
| InChI | InChI=1S/C20H28N4OS.HI/c1-3-21-20(24-15-16(2)17-9-5-4-6-10-17)23-13-8-12-22-19(25)18-11-7-14-26-18;/h4-7,9-11,14,16H,3,8,12-13,15H2,1-2H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | VCJNEYUXZKQMSV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|