C14H21F3N4OS — CID 109471821
N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 109471821) has the molecular formula C14H21F3N4OS and a molecular weight of 350.41 g/mol. Its IUPAC name is N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 109471821 |
| Molecular Formula | C14H21F3N4OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[3-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)NCCC(F)(F)F |
| InChI | InChI=1S/C14H21F3N4OS/c1-2-18-13(21-9-6-14(15,16)17)20-8-4-7-19-12(22)11-5-3-10-23-11/h3,5,10H,2,4,6-9H2,1H3,(H,19,22)(H2,18,20,21) |
| InChIKey | WQTRVBIMGPVTCO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|