C17H27N5O2S — CID 111927090
N-[3-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 111927090) has the molecular formula C17H27N5O2S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[3-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111927090 |
| Molecular Formula | C17H27N5O2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[3-[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C17H27N5O2S/c1-2-18-17(22-11-10-20-15(23)13-6-7-13)21-9-4-8-19-16(24)14-5-3-12-25-14/h3,5,12-13H,2,4,6-11H2,1H3,(H,19,24)(H,20,23)(H2,18,21,22) |
| InChIKey | DZKBMNMIWFQUCT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|