C16H26N4OS — CID 110991485
N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 110991485) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110991485 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[3-[[(cyclopentylamino)-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)NC1CCCC1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-17-16(20-13-7-3-4-8-13)19-11-6-10-18-15(21)14-9-5-12-22-14/h5,9,12-13H,2-4,6-8,10-11H2,1H3,(H,18,21)(H2,17,19,20) |
| InChIKey | UBWWKRYWSPJCFL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|