C21H30N4O3S — CID 111213869
N-[3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 111213869) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111213869 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[3-[[[2-(3,4-dimethoxyphenyl)ethylamino]-(ethylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H30N4O3S/c1-4-22-21(24-12-6-11-23-20(26)19-7-5-14-29-19)25-13-10-16-8-9-17(27-2)18(15-16)28-3/h5,7-9,14-15H,4,6,10-13H2,1-3H3,(H,23,26)(H2,22,24,25) |
| InChIKey | BNSIWUQLELFVDJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|