C19H23NO5S — CID 84559141
3-(thiophene-2-carbonylamino)propyl 3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 84559141) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-(thiophene-2-carbonylamino)propyl 3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | 3-(thiophene-2-carbonylamino)propyl 3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 84559141 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-(thiophene-2-carbonylamino)propyl 3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)OCCCNC(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C19H23NO5S/c1-23-15-8-6-14(13-16(15)24-2)7-9-18(21)25-11-4-10-20-19(22)17-5-3-12-26-17/h3,5-6,8,12-13H,4,7,9-11H2,1-2H3,(H,20,22) |
| InChIKey | ZEKWXIMCGSTXLB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|