C16H20N2O3S — CID 3156849
N-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]thiophene-2-carboxamide (PubChem CID 3156849) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3156849 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[2-[(3,4-dimethoxyphenyl)methylamino]ethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CNCCNC(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C16H20N2O3S/c1-20-13-6-5-12(10-14(13)21-2)11-17-7-8-18-16(19)15-4-3-9-22-15/h3-6,9-10,17H,7-8,11H2,1-2H3,(H,18,19) |
| InChIKey | DFTFUAZRCCGEOV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|