C24H25N3O5S — CID 121062906
N-[2-[[4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 121062906) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[2-[[4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121062906 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[2-[[4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)NCCNC(=O)c3cccs3)cc2)cc1OC |
| InChI | InChI=1S/C24H25N3O5S/c1-31-19-10-5-16(14-20(19)32-2)15-22(28)27-18-8-6-17(7-9-18)23(29)25-11-12-26-24(30)21-4-3-13-33-21/h3-10,13-14H,11-12,15H2,1-2H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | VOBXXKOCLVFDGT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|