C25H25N3O5S — CID 121063035
N-[2-[[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 121063035) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is N-[2-[[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121063035 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[2-[[4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]benzoyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(C(=O)NCCNC(=O)c3cccs3)cc2)cc1OC |
| InChI | InChI=1S/C25H25N3O5S/c1-32-20-11-5-17(16-21(20)33-2)6-12-23(29)28-19-9-7-18(8-10-19)24(30)26-13-14-27-25(31)22-4-3-15-34-22/h3-12,15-16H,13-14H2,1-2H3,(H,26,30)(H,27,31)(H,28,29)/b12-6+ |
| InChIKey | CRBPTHSNZZQCCN-WUXMJOGZSA-N |
| XLogP | 3.58 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|