C21H24N2O5 — CID 17218973
3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 17218973) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 17218973 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(NC(=O)/C=C/c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H24N2O5/c1-26-12-11-22-21(25)16-5-4-6-17(14-16)23-20(24)10-8-15-7-9-18(27-2)19(13-15)28-3/h4-10,13-14H,11-12H2,1-3H3,(H,22,25)(H,23,24)/b10-8+ |
| InChIKey | ZNOCTOBLDQLGOT-CSKARUKUSA-N |
| XLogP | 2.73 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|