C24H23N3O5S — CID 17200109
3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 17200109) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17200109 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2cccc(C(=O)NCc3ccco3)c2)cc1OC |
| InChI | InChI=1S/C24H23N3O5S/c1-30-20-10-8-16(13-21(20)31-2)9-11-22(28)27-24(33)26-18-6-3-5-17(14-18)23(29)25-15-19-7-4-12-32-19/h3-14H,15H2,1-2H3,(H,25,29)(H2,26,27,28,33)/b11-9+ |
| InChIKey | WTPHMWWTOBELDG-PKNBQFBNSA-N |
| XLogP | 3.75 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|