C21H23N3O4S — CID 17188609
(E)-3-(3,4-dimethoxyphenyl)-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17188609) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17188609 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1cccc(NC(=S)NC(=O)/C=C/c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H23N3O4S/c1-4-19(25)22-15-6-5-7-16(13-15)23-21(29)24-20(26)11-9-14-8-10-17(27-2)18(12-14)28-3/h5-13H,4H2,1-3H3,(H,22,25)(H2,23,24,26,29)/b11-9+ |
| InChIKey | GQPADWLOZVNUNO-PKNBQFBNSA-N |
| XLogP | 3.58 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|