C19H19ClN2O4S — CID 54788609
(E)-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 54788609) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is (E)-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54788609 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | (E)-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=S)NC(=O)/C=C/c2ccc(OC)c(OC)c2)cc1Cl |
| InChI | InChI=1S/C19H19ClN2O4S/c1-24-15-8-6-13(11-14(15)20)21-19(27)22-18(23)9-5-12-4-7-16(25-2)17(10-12)26-3/h4-11H,1-3H3,(H2,21,22,23,27)/b9-5+ |
| InChIKey | VLVFAJZGJDOAFK-WEVVVXLNSA-N |
| XLogP | 3.89 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|