C21H23NO5 — CID 9228215
ethyl 3-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 9228215) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is ethyl 3-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 3-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 9228215 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | ethyl 3-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)/C=C/c2ccc(OC)c(OCC)c2)c1 |
| InChI | InChI=1S/C21H23NO5/c1-4-26-19-13-15(9-11-18(19)25-3)10-12-20(23)22-17-8-6-7-16(14-17)21(24)27-5-2/h6-14H,4-5H2,1-3H3,(H,22,23)/b12-10+ |
| InChIKey | IJSSCTUBHCKYGQ-ZRDIBKRKSA-N |
| XLogP | 3.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|