C22H25NO5 — CID 3431507
propyl 3-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzoate (PubChem CID 3431507) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is propyl 3-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzoate.
| Compound Name | propyl 3-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 3431507 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | propyl 3-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)C=Cc2ccc(OCC)c(OC)c2)c1 |
| InChI | InChI=1S/C22H25NO5/c1-4-13-28-22(25)17-7-6-8-18(15-17)23-21(24)12-10-16-9-11-19(27-5-2)20(14-16)26-3/h6-12,14-15H,4-5,13H2,1-3H3,(H,23,24) |
| InChIKey | JIYZOWUFDCJZCR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|