C21H22BrNO5 — CID 4682877
propyl 3-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate (PubChem CID 4682877) has the molecular formula C21H22BrNO5 and a molecular weight of 448.31 g/mol. Its IUPAC name is propyl 3-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate.
| Compound Name | propyl 3-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 4682877 |
| Molecular Formula | C21H22BrNO5 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | propyl 3-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate |
| SMILES | CCCOC(=O)c1cccc(NC(=O)C=Cc2cc(Br)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H22BrNO5/c1-4-10-28-21(25)15-6-5-7-16(13-15)23-19(24)9-8-14-11-17(22)20(27-3)18(12-14)26-2/h5-9,11-13H,4,10H2,1-3H3,(H,23,24) |
| InChIKey | DRWPCSZNWAPUTL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|