C17H14BrCl2NO3 — CID 4192142
3-(3-bromo-4,5-dimethoxyphenyl)-N-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 4192142) has the molecular formula C17H14BrCl2NO3 and a molecular weight of 431.11 g/mol. Its IUPAC name is 3-(3-bromo-4,5-dimethoxyphenyl)-N-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | 3-(3-bromo-4,5-dimethoxyphenyl)-N-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4192142 |
| Molecular Formula | C17H14BrCl2NO3 |
| Molecular Weight | 431.11 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | 3-(3-bromo-4,5-dimethoxyphenyl)-N-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(Cl)c(Cl)c2)cc(Br)c1OC |
| InChI | InChI=1S/C17H14BrCl2NO3/c1-23-15-8-10(7-12(18)17(15)24-2)3-6-16(22)21-11-4-5-13(19)14(20)9-11/h3-9H,1-2H3,(H,21,22) |
| InChIKey | WTCOFBNVUMNNGY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.11 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|