C21H23ClN2O4 — CID 26679759
N-[4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanamide (PubChem CID 26679759) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-[4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 26679759 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-2-methylpropanamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(NC(=O)C(C)C)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H23ClN2O4/c1-13(2)21(26)24-16-8-6-15(7-9-16)23-19(25)10-5-14-11-17(22)20(28-4)18(12-14)27-3/h5-13H,1-4H3,(H,23,25)(H,24,26)/b10-5+ |
| InChIKey | HFGJHYXPXCYKQS-BJMVGYQFSA-N |
| XLogP | 4.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|