C19H19Cl2NO5 — CID 9438970
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 9438970) has the molecular formula C19H19Cl2NO5 and a molecular weight of 412.27 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9438970 |
| Molecular Formula | C19H19Cl2NO5 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO5/c1-24-15-10-14(16(25-2)9-12(15)20)22-18(23)6-5-11-7-13(21)19(27-4)17(8-11)26-3/h5-10H,1-4H3,(H,22,23)/b6-5+ |
| InChIKey | GFJBRQZIXABVMV-AATRIKPKSA-N |
| XLogP | 4.68 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|